C31H32F4N2O — CID 139875076
2-[2-[5-fluoro-6-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-pentylpyrimidine (PubChem CID 139875076) has the molecular formula C31H32F4N2O and a molecular weight of 524.60 g/mol. Its IUPAC name is 2-[2-[5-fluoro-6-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-pentylpyrimidine.
| Compound Name | 2-[2-[5-fluoro-6-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 139875076 |
| Molecular Formula | C31H32F4N2O |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 2-[2-[5-fluoro-6-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(CCc2ccc3c(F)c(CCc4ccc(OCC(F)(F)F)cc4)ccc3c2)nc1 |
| InChI | InChI=1S/C31H32F4N2O/c1-2-3-4-5-24-19-36-29(37-20-24)17-10-23-9-16-28-26(18-23)13-12-25(30(28)32)11-6-22-7-14-27(15-8-22)38-21-31(33,34)35/h7-9,12-16,18-20H,2-6,10-11,17,21H2,1H3 |
| InChIKey | QAWTUILFIKSQKT-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|