C29H26F4N2O — CID 139872944
5-but-3-enyl-2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]pyrimidine (PubChem CID 139872944) has the molecular formula C29H26F4N2O and a molecular weight of 494.53 g/mol. Its IUPAC name is 5-but-3-enyl-2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]pyrimidine.
| Compound Name | 5-but-3-enyl-2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]pyrimidine |
|---|---|
| PubChem CID | 139872944 |
| Molecular Formula | C29H26F4N2O |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 5-but-3-enyl-2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]pyrimidine |
| SMILES | C=CCCc1cnc(CCc2ccc3c(F)c(CCc4ccc(OC(F)(F)F)cc4)ccc3c2)nc1 |
| InChI | InChI=1S/C29H26F4N2O/c1-2-3-4-22-18-34-27(35-19-22)16-9-21-8-15-26-24(17-21)12-11-23(28(26)30)10-5-20-6-13-25(14-7-20)36-29(31,32)33/h2,6-8,11-15,17-19H,1,3-5,9-10,16H2 |
| InChIKey | VQXRXIZOCQEKCW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|