C27H22F4N2O — CID 139872667
5-but-3-enyl-2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]pyrimidine (PubChem CID 139872667) has the molecular formula C27H22F4N2O and a molecular weight of 466.48 g/mol. Its IUPAC name is 5-but-3-enyl-2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]pyrimidine.
| Compound Name | 5-but-3-enyl-2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]pyrimidine |
|---|---|
| PubChem CID | 139872667 |
| Molecular Formula | C27H22F4N2O |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 5-but-3-enyl-2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]pyrimidine |
| SMILES | C=CCCc1cnc(-c2ccc3c(F)c(CCc4ccc(OC(F)(F)F)cc4)ccc3c2)nc1 |
| InChI | InChI=1S/C27H22F4N2O/c1-2-3-4-19-16-32-26(33-17-19)22-11-14-24-21(15-22)10-9-20(25(24)28)8-5-18-6-12-23(13-7-18)34-27(29,30)31/h2,6-7,9-17H,1,3-5,8H2 |
| InChIKey | BAKQTGRRAPIVEE-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|