C27H24F2N2 — CID 139875379
2-[5-fluoro-6-[2-(4-fluorophenyl)ethyl]naphthalen-2-yl]-5-[(E)-pent-3-enyl]pyrimidine (PubChem CID 139875379) has the molecular formula C27H24F2N2 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[5-fluoro-6-[2-(4-fluorophenyl)ethyl]naphthalen-2-yl]-5-[(E)-pent-3-enyl]pyrimidine.
| Compound Name | 2-[5-fluoro-6-[2-(4-fluorophenyl)ethyl]naphthalen-2-yl]-5-[(E)-pent-3-enyl]pyrimidine |
|---|---|
| PubChem CID | 139875379 |
| Molecular Formula | C27H24F2N2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-[5-fluoro-6-[2-(4-fluorophenyl)ethyl]naphthalen-2-yl]-5-[(E)-pent-3-enyl]pyrimidine |
| SMILES | C/C=C/CCc1cnc(-c2ccc3c(F)c(CCc4ccc(F)cc4)ccc3c2)nc1 |
| InChI | InChI=1S/C27H24F2N2/c1-2-3-4-5-20-17-30-27(31-18-20)23-12-15-25-22(16-23)11-10-21(26(25)29)9-6-19-7-13-24(28)14-8-19/h2-3,7-8,10-18H,4-6,9H2,1H3/b3-2+ |
| InChIKey | PNTXEKNHYBLYDW-NSCUHMNNSA-N |
| XLogP | 6.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|