C29H26ClF3N2 — CID 139875702
2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-[(E)-pent-3-enyl]pyrimidine (PubChem CID 139875702) has the molecular formula C29H26ClF3N2 and a molecular weight of 494.99 g/mol. Its IUPAC name is 2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-[(E)-pent-3-enyl]pyrimidine.
| Compound Name | 2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-[(E)-pent-3-enyl]pyrimidine |
|---|---|
| PubChem CID | 139875702 |
| Molecular Formula | C29H26ClF3N2 |
| Molecular Weight | 494.99 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-[(E)-pent-3-enyl]pyrimidine |
| SMILES | C/C=C/CCc1cnc(CCc2ccc3c(F)c(CCc4cc(F)c(Cl)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C29H26ClF3N2/c1-2-3-4-5-21-17-34-27(35-18-21)13-8-19-7-12-24-23(14-19)11-10-22(29(24)33)9-6-20-15-25(31)28(30)26(32)16-20/h2-3,7,10-12,14-18H,4-6,8-9,13H2,1H3/b3-2+ |
| InChIKey | SZFIDMIBUDVYFM-NSCUHMNNSA-N |
| XLogP | 7.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.99 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|