C31H26F6O — CID 139873466
2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoro-6-[4-[(E)-pent-3-enyl]phenyl]naphthalene (PubChem CID 139873466) has the molecular formula C31H26F6O and a molecular weight of 528.54 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoro-6-[4-[(E)-pent-3-enyl]phenyl]naphthalene.
| Compound Name | 2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoro-6-[4-[(E)-pent-3-enyl]phenyl]naphthalene |
|---|---|
| PubChem CID | 139873466 |
| Molecular Formula | C31H26F6O |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoro-6-[4-[(E)-pent-3-enyl]phenyl]naphthalene |
| SMILES | C/C=C/CCc1ccc(-c2ccc3c(F)c(CCc4cc(F)c(OCC(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C31H26F6O/c1-2-3-4-5-20-6-9-22(10-7-20)24-14-15-26-25(18-24)13-12-23(29(26)34)11-8-21-16-27(32)30(28(33)17-21)38-19-31(35,36)37/h2-3,6-7,9-10,12-18H,4-5,8,11,19H2,1H3/b3-2+ |
| InChIKey | GVXUCUBIDHGOOY-NSCUHMNNSA-N |
| XLogP | 9.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|