C31H29F4NO — CID 139874621
2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-[(E)-pent-3-enyl]pyridine (PubChem CID 139874621) has the molecular formula C31H29F4NO and a molecular weight of 507.57 g/mol. Its IUPAC name is 2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-[(E)-pent-3-enyl]pyridine.
| Compound Name | 2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-[(E)-pent-3-enyl]pyridine |
|---|---|
| PubChem CID | 139874621 |
| Molecular Formula | C31H29F4NO |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-[(E)-pent-3-enyl]pyridine |
| SMILES | C/C=C/CCc1ccc(CCc2ccc3c(F)c(CCc4ccc(OC(F)(F)F)cc4)ccc3c2)nc1 |
| InChI | InChI=1S/C31H29F4NO/c1-2-3-4-5-24-8-16-27(36-21-24)15-7-23-11-19-29-26(20-23)14-13-25(30(29)32)12-6-22-9-17-28(18-10-22)37-31(33,34)35/h2-3,8-11,13-14,16-21H,4-7,12,15H2,1H3/b3-2+ |
| InChIKey | OIZCRKZBKMZYBG-NSCUHMNNSA-N |
| XLogP | 8.35 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|