C29H30F4O — CID 139871369
2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-6-[2-(4-ethenylcyclohexyl)ethyl]-1-fluoronaphthalene (PubChem CID 139871369) has the molecular formula C29H30F4O and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-6-[2-(4-ethenylcyclohexyl)ethyl]-1-fluoronaphthalene.
| Compound Name | 2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-6-[2-(4-ethenylcyclohexyl)ethyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139871369 |
| Molecular Formula | C29H30F4O |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-6-[2-(4-ethenylcyclohexyl)ethyl]-1-fluoronaphthalene |
| SMILES | C=CC1CCC(CCc2ccc3c(F)c(CCc4ccc(OC(F)F)c(F)c4)ccc3c2)CC1 |
| InChI | InChI=1S/C29H30F4O/c1-2-19-3-5-20(6-4-19)7-8-21-10-15-25-24(17-21)14-13-23(28(25)31)12-9-22-11-16-27(26(30)18-22)34-29(32)33/h2,10-11,13-20,29H,1,3-9,12H2 |
| InChIKey | WINJSQBYQPGJKZ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|