C22H15F7 — CID 139855763
6-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene (PubChem CID 139855763) has the molecular formula C22H15F7 and a molecular weight of 412.35 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene.
| Compound Name | 6-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 139855763 |
| Molecular Formula | C22H15F7 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 6-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene |
| SMILES | C/C=C/CCc1cc(F)c(-c2ccc3c(F)c(C(F)(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C22H15F7/c1-2-3-4-5-12-8-16(23)19(17(24)9-12)13-6-7-15-14(10-13)11-18(25)20(21(15)26)22(27,28)29/h2-3,6-11H,4-5H2,1H3/b3-2+ |
| InChIKey | NYRXNZQRENZGDA-NSCUHMNNSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|