C22H16F6 — CID 139856237
1,3,8-trifluoro-6-[4-[(E)-pent-3-enyl]phenyl]-2-(trifluoromethyl)naphthalene (PubChem CID 139856237) has the molecular formula C22H16F6 and a molecular weight of 394.36 g/mol. Its IUPAC name is 1,3,8-trifluoro-6-[4-[(E)-pent-3-enyl]phenyl]-2-(trifluoromethyl)naphthalene.
| Compound Name | 1,3,8-trifluoro-6-[4-[(E)-pent-3-enyl]phenyl]-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 139856237 |
| Molecular Formula | C22H16F6 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1,3,8-trifluoro-6-[4-[(E)-pent-3-enyl]phenyl]-2-(trifluoromethyl)naphthalene |
| SMILES | C/C=C/CCc1ccc(-c2cc(F)c3c(F)c(C(F)(F)F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C22H16F6/c1-2-3-4-5-13-6-8-14(9-7-13)15-10-16-12-18(24)20(22(26,27)28)21(25)19(16)17(23)11-15/h2-3,6-12H,4-5H2,1H3/b3-2+ |
| InChIKey | DLALQFGLKMFBQI-NSCUHMNNSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|