About 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile
3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile (PubChem CID 91132965) has the molecular formula C20H15F2N
and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile.
Molecular Properties
| Compound Name | 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile |
| PubChem CID | 91132965 |
| Molecular Formula | C20H15F2N |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile |
| SMILES | CC=CCCc1ccc(-c2cc(F)c(C#CC#N)c(F)c2)cc1 |
| InChI | InChI=1S/C20H15F2N/c1-2-3-4-6-15-8-10-16(11-9-15)17-13-19(21)18(7-5-12-23)20(22)14-17/h2-3,8-11,13-14H,4,6H2,1H3 |
| InChIKey | YVEOLHRICZQZNU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile?
The IUPAC name of 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile (CID 91132965) is 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile.
What is the SMILES notation for 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile?
The canonical SMILES for 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile is CC=CCCc1ccc(-c2cc(F)c(C#CC#N)c(F)c2)cc1.
What is the InChIKey of 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile?
The InChIKey is YVEOLHRICZQZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2N/c1-2-3-4-6-15-8-10-16(11-9-15)17-13-19(21)18(7-5-12-23)20(22)14-17/h2-3,8-11,13-14H,4,6H2,1H3.
What are the key properties of 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile?
3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile has a molecular weight of 307.34 g/mol, XLogP of 5.02, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-difluoro-4-(4-pent-3-enylphenyl)phenyl]prop-2-ynenitrile is sourced from PubChem (CID 91132965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).