C19H11F4N — CID 21138538
3-[4-[4-(4,4-difluorobut-3-enyl)phenyl]-2,6-difluorophenyl]prop-2-ynenitrile (PubChem CID 21138538) has the molecular formula C19H11F4N and a molecular weight of 329.30 g/mol. Its IUPAC name is 3-[4-[4-(4,4-difluorobut-3-enyl)phenyl]-2,6-difluorophenyl]prop-2-ynenitrile.
| Compound Name | 3-[4-[4-(4,4-difluorobut-3-enyl)phenyl]-2,6-difluorophenyl]prop-2-ynenitrile |
|---|---|
| PubChem CID | 21138538 |
| Molecular Formula | C19H11F4N |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-[4-[4-(4,4-difluorobut-3-enyl)phenyl]-2,6-difluorophenyl]prop-2-ynenitrile |
| SMILES | N#CC#Cc1c(F)cc(-c2ccc(CCC=C(F)F)cc2)cc1F |
| InChI | InChI=1S/C19H11F4N/c20-17-11-15(12-18(21)16(17)4-2-10-24)14-8-6-13(7-9-14)3-1-5-19(22)23/h5-9,11-12H,1,3H2 |
| InChIKey | TWCOWHIRZGGEJG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|