C26H17F7 — CID 59247240
1,3-difluoro-5-[2-fluoro-4-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2-(3,3,3-trifluoroprop-1-ynyl)benzene (PubChem CID 59247240) has the molecular formula C26H17F7 and a molecular weight of 462.41 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-fluoro-4-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2-(3,3,3-trifluoroprop-1-ynyl)benzene.
| Compound Name | 1,3-difluoro-5-[2-fluoro-4-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2-(3,3,3-trifluoroprop-1-ynyl)benzene |
|---|---|
| PubChem CID | 59247240 |
| Molecular Formula | C26H17F7 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 1,3-difluoro-5-[2-fluoro-4-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2-(3,3,3-trifluoroprop-1-ynyl)benzene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(-c3cc(F)c(C#CC(F)(F)F)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C26H17F7/c1-2-3-4-5-16-6-8-19(22(27)12-16)17-7-9-20(23(28)13-17)18-14-24(29)21(25(30)15-18)10-11-26(31,32)33/h2-3,6-9,12-15H,4-5H2,1H3/b3-2+ |
| InChIKey | WMUYBDIZPIJONZ-NSCUHMNNSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|