C18H12F4 — CID 139847368
6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene (PubChem CID 139847368) has the molecular formula C18H12F4 and a molecular weight of 304.29 g/mol. Its IUPAC name is 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 139847368 |
| Molecular Formula | C18H12F4 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCc1ccc(-c2cc(F)c3c(F)c(F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C18H12F4/c1-2-10-3-5-11(6-4-10)12-7-13-9-15(20)17(21)18(22)16(13)14(19)8-12/h3-9H,2H2,1H3 |
| InChIKey | YKIIMBUMHCVRMP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|