About 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene
6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene (PubChem CID 139847368) has the molecular formula C18H12F4
and a molecular weight of 304.29 g/mol. Its IUPAC name is 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene.
Molecular Properties
| Compound Name | 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene |
| PubChem CID | 139847368 |
| Molecular Formula | C18H12F4 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCc1ccc(-c2cc(F)c3c(F)c(F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C18H12F4/c1-2-10-3-5-11(6-4-10)12-7-13-9-15(20)17(21)18(22)16(13)14(19)8-12/h3-9H,2H2,1H3 |
| InChIKey | YKIIMBUMHCVRMP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene?
The IUPAC name of 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene (CID 139847368) is 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene.
What is the SMILES notation for 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene?
The canonical SMILES for 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene is CCc1ccc(-c2cc(F)c3c(F)c(F)c(F)cc3c2)cc1.
What is the InChIKey of 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene?
The InChIKey is YKIIMBUMHCVRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F4/c1-2-10-3-5-11(6-4-10)12-7-13-9-15(20)17(21)18(22)16(13)14(19)8-12/h3-9H,2H2,1H3.
What are the key properties of 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene?
6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene has a molecular weight of 304.29 g/mol, XLogP of 5.63, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-ethylphenyl)-1,2,3,8-tetrafluoronaphthalene is sourced from PubChem (CID 139847368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).