C22H25F3O5S — CID 87880744
methyl 2-methyl-4-[3-[3-methyl-4-(trifluoromethylsulfonyloxy)phenyl]pentyl]benzoate (PubChem CID 87880744) has the molecular formula C22H25F3O5S and a molecular weight of 458.50 g/mol. Its IUPAC name is methyl 2-methyl-4-[3-[3-methyl-4-(trifluoromethylsulfonyloxy)phenyl]pentyl]benzoate.
| Compound Name | methyl 2-methyl-4-[3-[3-methyl-4-(trifluoromethylsulfonyloxy)phenyl]pentyl]benzoate |
|---|---|
| PubChem CID | 87880744 |
| Molecular Formula | C22H25F3O5S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | methyl 2-methyl-4-[3-[3-methyl-4-(trifluoromethylsulfonyloxy)phenyl]pentyl]benzoate |
| SMILES | CCC(CCc1ccc(C(=O)OC)c(C)c1)c1ccc(OS(=O)(=O)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C22H25F3O5S/c1-5-17(8-6-16-7-10-19(14(2)12-16)21(26)29-4)18-9-11-20(15(3)13-18)30-31(27,28)22(23,24)25/h7,9-13,17H,5-6,8H2,1-4H3 |
| InChIKey | DHOPMLJUCHGMPC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|