C13H14ClF3O3S — CID 101053325
[4-chloro-2-(2,3-dimethylbut-2-enyl)phenyl] trifluoromethanesulfonate (PubChem CID 101053325) has the molecular formula C13H14ClF3O3S and a molecular weight of 342.77 g/mol. Its IUPAC name is [4-chloro-2-(2,3-dimethylbut-2-enyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-chloro-2-(2,3-dimethylbut-2-enyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101053325 |
| Molecular Formula | C13H14ClF3O3S |
| Molecular Weight | 342.77 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | [4-chloro-2-(2,3-dimethylbut-2-enyl)phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)=C(C)Cc1cc(Cl)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H14ClF3O3S/c1-8(2)9(3)6-10-7-11(14)4-5-12(10)20-21(18,19)13(15,16)17/h4-5,7H,6H2,1-3H3 |
| InChIKey | SZRXZLMBCPYYRX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.77 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|