C10H8ClF3O4S — CID 89027463
[2-chloro-4-(2-oxopropyl)phenyl] trifluoromethanesulfonate (PubChem CID 89027463) has the molecular formula C10H8ClF3O4S and a molecular weight of 316.68 g/mol. Its IUPAC name is [2-chloro-4-(2-oxopropyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2-chloro-4-(2-oxopropyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89027463 |
| Molecular Formula | C10H8ClF3O4S |
| Molecular Weight | 316.68 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | [2-chloro-4-(2-oxopropyl)phenyl] trifluoromethanesulfonate |
| SMILES | CC(=O)Cc1ccc(OS(=O)(=O)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H8ClF3O4S/c1-6(15)4-7-2-3-9(8(11)5-7)18-19(16,17)10(12,13)14/h2-3,5H,4H2,1H3 |
| InChIKey | JHXUHGXAMVJUCY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.68 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|