C11H14F3O5PS — CID 157202526
[2-(dimethylphosphorylmethyl)-4-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 157202526) has the molecular formula C11H14F3O5PS and a molecular weight of 346.26 g/mol. Its IUPAC name is [2-(dimethylphosphorylmethyl)-4-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [2-(dimethylphosphorylmethyl)-4-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 157202526 |
| Molecular Formula | C11H14F3O5PS |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | [2-(dimethylphosphorylmethyl)-4-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(OS(=O)(=O)C(F)(F)F)c(CP(C)(C)=O)c1 |
| InChI | InChI=1S/C11H14F3O5PS/c1-18-9-4-5-10(8(6-9)7-20(2,3)15)19-21(16,17)11(12,13)14/h4-6H,7H2,1-3H3 |
| InChIKey | AQYRGCPMWXFQDY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|