About 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate
2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate (PubChem CID 86589678) has the molecular formula C15H13F5O6S
and a molecular weight of 416.32 g/mol. Its IUPAC name is 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate |
| PubChem CID | 86589678 |
| Molecular Formula | C15H13F5O6S |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate |
| SMILES | COc1ccc(O)c(F)c1.COc1ccc(OS(=O)(=O)C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C8H6F4O4S.C7H7FO2/c1-15-5-2-3-7(6(9)4-5)16-17(13,14)8(10,11)12;1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3;2-4,9H,1H3 |
| InChIKey | NKFUGILLRDPWKI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate?
The IUPAC name of 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate (CID 86589678) is 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate.
What is the SMILES notation for 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate?
The canonical SMILES for 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate is COc1ccc(O)c(F)c1.COc1ccc(OS(=O)(=O)C(F)(F)F)c(F)c1.
What is the InChIKey of 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate?
The InChIKey is NKFUGILLRDPWKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F4O4S.C7H7FO2/c1-15-5-2-3-7(6(9)4-5)16-17(13,14)8(10,11)12;1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3;2-4,9H,1H3.
What are the key properties of 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate?
2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate has a molecular weight of 416.32 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-methoxyphenol;(2-fluoro-4-methoxyphenyl) trifluoromethanesulfonate is sourced from PubChem (CID 86589678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).