About [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate
[4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate (PubChem CID 134505136) has the molecular formula C11H15F3O4S2
and a molecular weight of 332.37 g/mol. Its IUPAC name is [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 134505136 |
| Molecular Formula | C11H15F3O4S2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(OS(=O)(=O)C(F)(F)F)c(S(C)(C)C)c1 |
| InChI | InChI=1S/C11H15F3O4S2/c1-17-8-5-6-9(10(7-8)19(2,3)4)18-20(15,16)11(12,13)14/h5-7H,1-4H3 |
| InChIKey | JCUYELOEEYBKNO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate (CID 134505136) is [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate is COc1ccc(OS(=O)(=O)C(F)(F)F)c(S(C)(C)C)c1.
What is the InChIKey of [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate?
The InChIKey is JCUYELOEEYBKNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3O4S2/c1-17-8-5-6-9(10(7-8)19(2,3)4)18-20(15,16)11(12,13)14/h5-7H,1-4H3.
What are the key properties of [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate?
[4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate has a molecular weight of 332.37 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-2-(trimethyl-λ4-sulfanyl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 134505136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).