C16H15F3O8S2 — CID 23538226
[2,5-dimethoxy-4-(4-methylsulfonyloxyphenyl)phenyl] trifluoromethanesulfonate (PubChem CID 23538226) has the molecular formula C16H15F3O8S2 and a molecular weight of 456.42 g/mol. Its IUPAC name is [2,5-dimethoxy-4-(4-methylsulfonyloxyphenyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2,5-dimethoxy-4-(4-methylsulfonyloxyphenyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23538226 |
| Molecular Formula | C16H15F3O8S2 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | [2,5-dimethoxy-4-(4-methylsulfonyloxyphenyl)phenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)c(OC)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H15F3O8S2/c1-24-13-9-15(27-29(22,23)16(17,18)19)14(25-2)8-12(13)10-4-6-11(7-5-10)26-28(3,20)21/h4-9H,1-3H3 |
| InChIKey | NFICUYSCNJTTFT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|