C21H20FNO5S — CID 23538895
[4-[4-(4-amino-3-fluorophenyl)-2,5-dimethoxyphenyl]phenyl] methanesulfonate (PubChem CID 23538895) has the molecular formula C21H20FNO5S and a molecular weight of 417.46 g/mol. Its IUPAC name is [4-[4-(4-amino-3-fluorophenyl)-2,5-dimethoxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[4-(4-amino-3-fluorophenyl)-2,5-dimethoxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538895 |
| Molecular Formula | C21H20FNO5S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [4-[4-(4-amino-3-fluorophenyl)-2,5-dimethoxyphenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(N)c(F)c2)c(OC)cc1-c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H20FNO5S/c1-26-20-12-17(14-6-9-19(23)18(22)10-14)21(27-2)11-16(20)13-4-7-15(8-5-13)28-29(3,24)25/h4-12H,23H2,1-3H3 |
| InChIKey | TZZULKXFABUTNM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|