C28H31FO9S2 — CID 23538359
[4-[4-[3-fluoro-4-(4-methylpent-3-enoxy)phenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate (PubChem CID 23538359) has the molecular formula C28H31FO9S2 and a molecular weight of 594.68 g/mol. Its IUPAC name is [4-[4-[3-fluoro-4-(4-methylpent-3-enoxy)phenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[4-[3-fluoro-4-(4-methylpent-3-enoxy)phenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538359 |
| Molecular Formula | C28H31FO9S2 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | [4-[4-[3-fluoro-4-(4-methylpent-3-enoxy)phenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(OCCC=C(C)C)c(F)c1 |
| InChI | InChI=1S/C28H31FO9S2/c1-18(2)8-7-15-36-24-14-11-20(16-23(24)29)26-25(34-3)17-22(27(35-4)28(26)38-40(6,32)33)19-9-12-21(13-10-19)37-39(5,30)31/h8-14,16-17H,7,15H2,1-6H3 |
| InChIKey | XZLJKAPHUYVRCN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|