C27H29FO8S2 — CID 23538349
[4-[4-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-2-methoxy-5-methyl-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate (PubChem CID 23538349) has the molecular formula C27H29FO8S2 and a molecular weight of 564.65 g/mol. Its IUPAC name is [4-[4-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-2-methoxy-5-methyl-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[4-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-2-methoxy-5-methyl-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538349 |
| Molecular Formula | C27H29FO8S2 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | [4-[4-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-2-methoxy-5-methyl-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
| SMILES | COc1c(-c2ccc(OS(C)(=O)=O)cc2)cc(C)c(-c2ccc(OCC=C(C)C)c(F)c2)c1OS(C)(=O)=O |
| InChI | InChI=1S/C27H29FO8S2/c1-17(2)13-14-34-24-12-9-20(16-23(24)28)25-18(3)15-22(26(33-4)27(25)36-38(6,31)32)19-7-10-21(11-8-19)35-37(5,29)30/h7-13,15-16H,14H2,1-6H3 |
| InChIKey | IRRQNVXPERQXQT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|