C28H32O9S2 — CID 21049199
[4-[2,5-dimethoxy-4-[3-methyl-4-(3-methylbut-3-enoxy)phenyl]-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate (PubChem CID 21049199) has the molecular formula C28H32O9S2 and a molecular weight of 576.69 g/mol. Its IUPAC name is [4-[2,5-dimethoxy-4-[3-methyl-4-(3-methylbut-3-enoxy)phenyl]-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[2,5-dimethoxy-4-[3-methyl-4-(3-methylbut-3-enoxy)phenyl]-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 21049199 |
| Molecular Formula | C28H32O9S2 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | [4-[2,5-dimethoxy-4-[3-methyl-4-(3-methylbut-3-enoxy)phenyl]-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
| SMILES | C=C(C)CCOc1ccc(-c2c(OC)cc(-c3ccc(OS(C)(=O)=O)cc3)c(OC)c2OS(C)(=O)=O)cc1C |
| InChI | InChI=1S/C28H32O9S2/c1-18(2)14-15-35-24-13-10-21(16-19(24)3)26-25(33-4)17-23(27(34-5)28(26)37-39(7,31)32)20-8-11-22(12-9-20)36-38(6,29)30/h8-13,16-17H,1,14-15H2,2-7H3 |
| InChIKey | HFOPWUAEDIQZGJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|