C32H32O14S3 — CID 23538931
[4-[[4-[3,6-dimethoxy-2-methylsulfonyloxy-4-(4-methylsulfonyloxyphenyl)phenyl]-2-methylsulfonyloxyphenoxy]methyl]phenyl] acetate (PubChem CID 23538931) has the molecular formula C32H32O14S3 and a molecular weight of 736.79 g/mol. Its IUPAC name is [4-[[4-[3,6-dimethoxy-2-methylsulfonyloxy-4-(4-methylsulfonyloxyphenyl)phenyl]-2-methylsulfonyloxyphenoxy]methyl]phenyl] acetate.
| Compound Name | [4-[[4-[3,6-dimethoxy-2-methylsulfonyloxy-4-(4-methylsulfonyloxyphenyl)phenyl]-2-methylsulfonyloxyphenoxy]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 23538931 |
| Molecular Formula | C32H32O14S3 |
| Molecular Weight | 736.79 g/mol |
| Exact Mass | 736.10 |
| IUPAC Name | [4-[[4-[3,6-dimethoxy-2-methylsulfonyloxy-4-(4-methylsulfonyloxyphenyl)phenyl]-2-methylsulfonyloxyphenoxy]methyl]phenyl] acetate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(OCc2ccc(OC(C)=O)cc2)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C32H32O14S3/c1-20(33)43-24-12-7-21(8-13-24)19-42-27-16-11-23(17-28(27)45-48(5,36)37)30-29(40-2)18-26(31(41-3)32(30)46-49(6,38)39)22-9-14-25(15-10-22)44-47(4,34)35/h7-18H,19H2,1-6H3 |
| InChIKey | DSOCBLKLWWBNEC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 184.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|