C30H30O9S2 — CID 23538110
[4-[3,5-dimethoxy-4-[4-[(4-methylphenyl)methoxy]-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate (PubChem CID 23538110) has the molecular formula C30H30O9S2 and a molecular weight of 598.70 g/mol. Its IUPAC name is [4-[3,5-dimethoxy-4-[4-[(4-methylphenyl)methoxy]-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate.
| Compound Name | [4-[3,5-dimethoxy-4-[4-[(4-methylphenyl)methoxy]-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538110 |
| Molecular Formula | C30H30O9S2 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | [4-[3,5-dimethoxy-4-[4-[(4-methylphenyl)methoxy]-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)cc(OC)c1-c1ccc(OCc2ccc(C)cc2)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C30H30O9S2/c1-20-6-8-21(9-7-20)19-37-26-15-12-23(16-27(26)39-41(5,33)34)30-28(35-2)17-24(18-29(30)36-3)22-10-13-25(14-11-22)38-40(4,31)32/h6-18H,19H2,1-5H3 |
| InChIKey | ZMHGCXQARMYAAL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|