C30H31NO9S2 — CID 23539143
[5-[4-(3-amino-4-methylphenyl)-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate (PubChem CID 23539143) has the molecular formula C30H31NO9S2 and a molecular weight of 613.71 g/mol. Its IUPAC name is [5-[4-(3-amino-4-methylphenyl)-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate.
| Compound Name | [5-[4-(3-amino-4-methylphenyl)-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 23539143 |
| Molecular Formula | C30H31NO9S2 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.14 |
| IUPAC Name | [5-[4-(3-amino-4-methylphenyl)-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(C)c(N)c2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(OCc2ccccc2)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C30H31NO9S2/c1-19-11-12-21(15-24(19)31)23-17-27(36-2)28(30(29(23)37-3)40-42(5,34)35)22-13-14-25(26(16-22)39-41(4,32)33)38-18-20-9-7-6-8-10-20/h6-17H,18,31H2,1-5H3 |
| InChIKey | HZBXNTDKWPVOSS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|