C28H28N2O9S2 — CID 20585522
[5-[4-(5-amino-2-pyridinyl)-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate (PubChem CID 20585522) has the molecular formula C28H28N2O9S2 and a molecular weight of 600.67 g/mol. Its IUPAC name is [5-[4-(5-amino-2-pyridinyl)-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate.
| Compound Name | [5-[4-(5-amino-2-pyridinyl)-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 20585522 |
| Molecular Formula | C28H28N2O9S2 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | [5-[4-(5-amino-2-pyridinyl)-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(N)cn2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(OCc2ccccc2)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C28H28N2O9S2/c1-35-25-15-21(22-12-11-20(29)16-30-22)27(36-2)28(39-41(4,33)34)26(25)19-10-13-23(24(14-19)38-40(3,31)32)37-17-18-8-6-5-7-9-18/h5-16H,17,29H2,1-4H3 |
| InChIKey | FZGLOMUJSPEODJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 153.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|