C31H32O7S — CID 23538765
[2-(3-hydroxy-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-propan-2-ylphenyl)phenyl] methanesulfonate (PubChem CID 23538765) has the molecular formula C31H32O7S and a molecular weight of 548.66 g/mol. Its IUPAC name is [2-(3-hydroxy-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-propan-2-ylphenyl)phenyl] methanesulfonate.
| Compound Name | [2-(3-hydroxy-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-propan-2-ylphenyl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538765 |
| Molecular Formula | C31H32O7S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | [2-(3-hydroxy-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-propan-2-ylphenyl)phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(C(C)C)cc2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(OCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C31H32O7S/c1-20(2)22-11-13-23(14-12-22)25-18-28(35-3)29(31(30(25)36-4)38-39(5,33)34)24-15-16-27(26(32)17-24)37-19-21-9-7-6-8-10-21/h6-18,20,32H,19H2,1-5H3 |
| InChIKey | KHFJJFLFQUVPLS-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|