C27H23NO7 — CID 23538576
2-(3-hydroxy-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-nitrophenyl)phenol (PubChem CID 23538576) has the molecular formula C27H23NO7 and a molecular weight of 473.48 g/mol. Its IUPAC name is 2-(3-hydroxy-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-nitrophenyl)phenol.
| Compound Name | 2-(3-hydroxy-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-nitrophenyl)phenol |
|---|---|
| PubChem CID | 23538576 |
| Molecular Formula | C27H23NO7 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 2-(3-hydroxy-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-nitrophenyl)phenol |
| SMILES | COc1cc(-c2ccc([N+](=O)[O-])cc2)c(OC)c(O)c1-c1ccc(OCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C27H23NO7/c1-33-24-15-21(18-8-11-20(12-9-18)28(31)32)27(34-2)26(30)25(24)19-10-13-23(22(29)14-19)35-16-17-6-4-3-5-7-17/h3-15,29-30H,16H2,1-2H3 |
| InChIKey | OTPPSISULWTODH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|