C28H27NO7S — CID 23539095
[4-[3-amino-4-(3-hydroxy-4-phenylmethoxyphenyl)-2,5-dimethoxyphenyl]phenyl] methanesulfonate (PubChem CID 23539095) has the molecular formula C28H27NO7S and a molecular weight of 521.59 g/mol. Its IUPAC name is [4-[3-amino-4-(3-hydroxy-4-phenylmethoxyphenyl)-2,5-dimethoxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[3-amino-4-(3-hydroxy-4-phenylmethoxyphenyl)-2,5-dimethoxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23539095 |
| Molecular Formula | C28H27NO7S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | [4-[3-amino-4-(3-hydroxy-4-phenylmethoxyphenyl)-2,5-dimethoxyphenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)c(OC)c(N)c1-c1ccc(OCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C28H27NO7S/c1-33-25-16-22(19-9-12-21(13-10-19)36-37(3,31)32)28(34-2)27(29)26(25)20-11-14-24(23(30)15-20)35-17-18-7-5-4-6-8-18/h4-16,30H,17,29H2,1-3H3 |
| InChIKey | VZRPZGQJYDTVBE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|