C30H29FO10S2 — CID 23538555
[4-[4-(3-fluoro-4-phenylmethoxyphenyl)-5-methoxy-2-(methoxymethoxy)-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate (PubChem CID 23538555) has the molecular formula C30H29FO10S2 and a molecular weight of 632.68 g/mol. Its IUPAC name is [4-[4-(3-fluoro-4-phenylmethoxyphenyl)-5-methoxy-2-(methoxymethoxy)-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[4-(3-fluoro-4-phenylmethoxyphenyl)-5-methoxy-2-(methoxymethoxy)-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538555 |
| Molecular Formula | C30H29FO10S2 |
| Molecular Weight | 632.68 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | [4-[4-(3-fluoro-4-phenylmethoxyphenyl)-5-methoxy-2-(methoxymethoxy)-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
| SMILES | COCOc1c(-c2ccc(OS(C)(=O)=O)cc2)cc(OC)c(-c2ccc(OCc3ccccc3)c(F)c2)c1OS(C)(=O)=O |
| InChI | InChI=1S/C30H29FO10S2/c1-36-19-39-29-24(21-10-13-23(14-11-21)40-42(3,32)33)17-27(37-2)28(30(29)41-43(4,34)35)22-12-15-26(25(31)16-22)38-18-20-8-6-5-7-9-20/h5-17H,18-19H2,1-4H3 |
| InChIKey | FABKVTFPOJOPJF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|