C32H32O11S2 — CID 23538146
[5-[3,6-dimethoxy-4-[4-(2-methoxyacetyl)phenyl]-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate (PubChem CID 23538146) has the molecular formula C32H32O11S2 and a molecular weight of 656.73 g/mol. Its IUPAC name is [5-[3,6-dimethoxy-4-[4-(2-methoxyacetyl)phenyl]-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate.
| Compound Name | [5-[3,6-dimethoxy-4-[4-(2-methoxyacetyl)phenyl]-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538146 |
| Molecular Formula | C32H32O11S2 |
| Molecular Weight | 656.73 g/mol |
| Exact Mass | 656.14 |
| IUPAC Name | [5-[3,6-dimethoxy-4-[4-(2-methoxyacetyl)phenyl]-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate |
| SMILES | COCC(=O)c1ccc(-c2cc(OC)c(-c3ccc(OCc4ccccc4)c(OS(C)(=O)=O)c3)c(OS(C)(=O)=O)c2OC)cc1 |
| InChI | InChI=1S/C32H32O11S2/c1-38-20-26(33)23-13-11-22(12-14-23)25-18-29(39-2)30(32(31(25)40-3)43-45(5,36)37)24-15-16-27(28(17-24)42-44(4,34)35)41-19-21-9-7-6-8-10-21/h6-18H,19-20H2,1-5H3 |
| InChIKey | WRKPWHGVYICCFW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.73 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|