C30H30O10S2 — CID 23539004
[5-[4-[4-(hydroxymethyl)phenyl]-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate (PubChem CID 23539004) has the molecular formula C30H30O10S2 and a molecular weight of 614.69 g/mol. Its IUPAC name is [5-[4-[4-(hydroxymethyl)phenyl]-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate.
| Compound Name | [5-[4-[4-(hydroxymethyl)phenyl]-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 23539004 |
| Molecular Formula | C30H30O10S2 |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.13 |
| IUPAC Name | [5-[4-[4-(hydroxymethyl)phenyl]-3,6-dimethoxy-2-methylsulfonyloxyphenyl]-2-phenylmethoxyphenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(CO)cc2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(OCc2ccccc2)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C30H30O10S2/c1-36-27-17-24(22-12-10-20(18-31)11-13-22)29(37-2)30(40-42(4,34)35)28(27)23-14-15-25(26(16-23)39-41(3,32)33)38-19-21-8-6-5-7-9-21/h5-17,31H,18-19H2,1-4H3 |
| InChIKey | SZNNBJDPNGLLNJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|