C29H25FO7S — CID 21049301
[4-[5-(3-fluoro-4-phenylmethoxyphenyl)-6-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl]phenyl] methanesulfonate (PubChem CID 21049301) has the molecular formula C29H25FO7S and a molecular weight of 536.58 g/mol. Its IUPAC name is [4-[5-(3-fluoro-4-phenylmethoxyphenyl)-6-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl]phenyl] methanesulfonate.
| Compound Name | [4-[5-(3-fluoro-4-phenylmethoxyphenyl)-6-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 21049301 |
| Molecular Formula | C29H25FO7S |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | [4-[5-(3-fluoro-4-phenylmethoxyphenyl)-6-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)c2c(c1-c1ccc(OCc3ccccc3)c(F)c1)OCCO2 |
| InChI | InChI=1S/C29H25FO7S/c1-33-26-17-23(20-8-11-22(12-9-20)37-38(2,31)32)28-29(35-15-14-34-28)27(26)21-10-13-25(24(30)16-21)36-18-19-6-4-3-5-7-19/h3-13,16-17H,14-15,18H2,1-2H3 |
| InChIKey | FONJPIAUIPGLKS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|