C28H24F2O7S2 — CID 23538195
[4-[2,5-difluoro-4-[4-[(4-methylphenyl)methoxy]-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate (PubChem CID 23538195) has the molecular formula C28H24F2O7S2 and a molecular weight of 574.62 g/mol. Its IUPAC name is [4-[2,5-difluoro-4-[4-[(4-methylphenyl)methoxy]-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate.
| Compound Name | [4-[2,5-difluoro-4-[4-[(4-methylphenyl)methoxy]-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538195 |
| Molecular Formula | C28H24F2O7S2 |
| Molecular Weight | 574.62 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | [4-[2,5-difluoro-4-[4-[(4-methylphenyl)methoxy]-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate |
| SMILES | Cc1ccc(COc2ccc(-c3cc(F)c(-c4ccc(OS(C)(=O)=O)cc4)cc3F)cc2OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H24F2O7S2/c1-18-4-6-19(7-5-18)17-35-27-13-10-21(14-28(27)37-39(3,33)34)24-16-25(29)23(15-26(24)30)20-8-11-22(12-9-20)36-38(2,31)32/h4-16H,17H2,1-3H3 |
| InChIKey | MVKZAQVFAMZDBN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|