C38H40N2O8S2 — CID 23538689
[5-[2,5-bis(dimethylamino)-4-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)phenyl]-2-phenylmethoxyphenyl] methanesulfonate (PubChem CID 23538689) has the molecular formula C38H40N2O8S2 and a molecular weight of 716.88 g/mol. Its IUPAC name is [5-[2,5-bis(dimethylamino)-4-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)phenyl]-2-phenylmethoxyphenyl] methanesulfonate.
| Compound Name | [5-[2,5-bis(dimethylamino)-4-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)phenyl]-2-phenylmethoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538689 |
| Molecular Formula | C38H40N2O8S2 |
| Molecular Weight | 716.88 g/mol |
| Exact Mass | 716.22 |
| IUPAC Name | [5-[2,5-bis(dimethylamino)-4-(3-methylsulfonyloxy-4-phenylmethoxyphenyl)phenyl]-2-phenylmethoxyphenyl] methanesulfonate |
| SMILES | CN(C)c1cc(-c2ccc(OCc3ccccc3)c(OS(C)(=O)=O)c2)c(N(C)C)cc1-c1ccc(OCc2ccccc2)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C38H40N2O8S2/c1-39(2)33-23-32(30-18-20-36(38(22-30)48-50(6,43)44)46-26-28-15-11-8-12-16-28)34(40(3)4)24-31(33)29-17-19-35(37(21-29)47-49(5,41)42)45-25-27-13-9-7-10-14-27/h7-24H,25-26H2,1-6H3 |
| InChIKey | NKBMAHMYNOHKQC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.88 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|