C28H32O7S2 — CID 23538266
[4-[2,5-dimethyl-4-[4-(4-methylpent-3-enoxy)-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate (PubChem CID 23538266) has the molecular formula C28H32O7S2 and a molecular weight of 544.69 g/mol. Its IUPAC name is [4-[2,5-dimethyl-4-[4-(4-methylpent-3-enoxy)-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate.
| Compound Name | [4-[2,5-dimethyl-4-[4-(4-methylpent-3-enoxy)-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538266 |
| Molecular Formula | C28H32O7S2 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | [4-[2,5-dimethyl-4-[4-(4-methylpent-3-enoxy)-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate |
| SMILES | CC(C)=CCCOc1ccc(-c2cc(C)c(-c3ccc(OS(C)(=O)=O)cc3)cc2C)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C28H32O7S2/c1-19(2)8-7-15-33-27-14-11-23(18-28(27)35-37(6,31)32)26-17-20(3)25(16-21(26)4)22-9-12-24(13-10-22)34-36(5,29)30/h8-14,16-18H,7,15H2,1-6H3 |
| InChIKey | KHXVXJLAQVALNZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|