C27H35NO5S — CID 59031506
[5-[2,5-dimethyl-4-[(E)-2-methyl-3-oxo-3-(propan-2-ylamino)prop-1-enyl]phenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate (PubChem CID 59031506) has the molecular formula C27H35NO5S and a molecular weight of 485.65 g/mol. Its IUPAC name is [5-[2,5-dimethyl-4-[(E)-2-methyl-3-oxo-3-(propan-2-ylamino)prop-1-enyl]phenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate.
| Compound Name | [5-[2,5-dimethyl-4-[(E)-2-methyl-3-oxo-3-(propan-2-ylamino)prop-1-enyl]phenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 59031506 |
| Molecular Formula | C27H35NO5S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [5-[2,5-dimethyl-4-[(E)-2-methyl-3-oxo-3-(propan-2-ylamino)prop-1-enyl]phenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate |
| SMILES | CC(C)=CCOc1ccc(-c2cc(C)c(/C=C(\C)C(=O)NC(C)C)cc2C)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C27H35NO5S/c1-17(2)11-12-32-25-10-9-22(16-26(25)33-34(8,30)31)24-15-19(5)23(13-20(24)6)14-21(7)27(29)28-18(3)4/h9-11,13-16,18H,12H2,1-8H3,(H,28,29)/b21-14+ |
| InChIKey | QCFMOYPNOCUJIX-KGENOOAVSA-N |
| XLogP | 5.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|