C27H27FO8S — CID 23538680
2-(4-fluorophenyl)-3,6-dimethoxy-5-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]benzoic acid (PubChem CID 23538680) has the molecular formula C27H27FO8S and a molecular weight of 530.57 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3,6-dimethoxy-5-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]benzoic acid.
| Compound Name | 2-(4-fluorophenyl)-3,6-dimethoxy-5-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 23538680 |
| Molecular Formula | C27H27FO8S |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 2-(4-fluorophenyl)-3,6-dimethoxy-5-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]benzoic acid |
| SMILES | COc1cc(-c2ccc(OCC=C(C)C)c(OS(C)(=O)=O)c2)c(OC)c(C(=O)O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H27FO8S/c1-16(2)12-13-35-21-11-8-18(14-22(21)36-37(5,31)32)20-15-23(33-3)24(17-6-9-19(28)10-7-17)25(27(29)30)26(20)34-4/h6-12,14-15H,13H2,1-5H3,(H,29,30) |
| InChIKey | MMFKDLPATRILPO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|