C27H29FO6 — CID 23539153
5-[4-(4-fluorophenyl)-3,6-dimethoxy-2-(methoxymethoxy)phenyl]-2-(3-methylbut-2-enoxy)phenol (PubChem CID 23539153) has the molecular formula C27H29FO6 and a molecular weight of 468.52 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)-3,6-dimethoxy-2-(methoxymethoxy)phenyl]-2-(3-methylbut-2-enoxy)phenol.
| Compound Name | 5-[4-(4-fluorophenyl)-3,6-dimethoxy-2-(methoxymethoxy)phenyl]-2-(3-methylbut-2-enoxy)phenol |
|---|---|
| PubChem CID | 23539153 |
| Molecular Formula | C27H29FO6 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 5-[4-(4-fluorophenyl)-3,6-dimethoxy-2-(methoxymethoxy)phenyl]-2-(3-methylbut-2-enoxy)phenol |
| SMILES | COCOc1c(OC)c(-c2ccc(F)cc2)cc(OC)c1-c1ccc(OCC=C(C)C)c(O)c1 |
| InChI | InChI=1S/C27H29FO6/c1-17(2)12-13-33-23-11-8-19(14-22(23)29)25-24(31-4)15-21(18-6-9-20(28)10-7-18)26(32-5)27(25)34-16-30-3/h6-12,14-15,29H,13,16H2,1-5H3 |
| InChIKey | NDPJACKGWRJRMO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|