C27H28O8 — CID 23538313
2-[2-[3-hydroxy-4-(3-methylbut-2-enoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenoxy]acetic acid (PubChem CID 23538313) has the molecular formula C27H28O8 and a molecular weight of 480.51 g/mol. Its IUPAC name is 2-[2-[3-hydroxy-4-(3-methylbut-2-enoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[3-hydroxy-4-(3-methylbut-2-enoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 23538313 |
| Molecular Formula | C27H28O8 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-[2-[3-hydroxy-4-(3-methylbut-2-enoxy)phenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenoxy]acetic acid |
| SMILES | COc1cc(-c2ccc(O)cc2)c(OC)c(OCC(=O)O)c1-c1ccc(OCC=C(C)C)c(O)c1 |
| InChI | InChI=1S/C27H28O8/c1-16(2)11-12-34-22-10-7-18(13-21(22)29)25-23(32-3)14-20(17-5-8-19(28)9-6-17)26(33-4)27(25)35-15-24(30)31/h5-11,13-14,28-29H,12,15H2,1-4H3,(H,30,31) |
| InChIKey | GFCSCQBFZYTTMW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|