C25H26O3 — CID 23539173
5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol (PubChem CID 23539173) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol.
| Compound Name | 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol |
|---|---|
| PubChem CID | 23539173 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol |
| SMILES | CC(C)=CCOc1ccc(-c2cc(C)c(-c3ccc(O)cc3)c(C)c2)cc1O |
| InChI | InChI=1S/C25H26O3/c1-16(2)11-12-28-24-10-7-20(15-23(24)27)21-13-17(3)25(18(4)14-21)19-5-8-22(26)9-6-19/h5-11,13-15,26-27H,12H2,1-4H3 |
| InChIKey | UNNYGPSANBNIKJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|