About 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol
5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol (PubChem CID 23539173) has the molecular formula C25H26O3
and a molecular weight of 374.48 g/mol. Its IUPAC name is 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol.
Molecular Properties
| Compound Name | 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol |
| PubChem CID | 23539173 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol |
| SMILES | CC(C)=CCOc1ccc(-c2cc(C)c(-c3ccc(O)cc3)c(C)c2)cc1O |
| InChI | InChI=1S/C25H26O3/c1-16(2)11-12-28-24-10-7-20(15-23(24)27)21-13-17(3)25(18(4)14-21)19-5-8-22(26)9-6-19/h5-11,13-15,26-27H,12H2,1-4H3 |
| InChIKey | UNNYGPSANBNIKJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol?
The IUPAC name of 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol (CID 23539173) is 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol.
What is the SMILES notation for 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol?
The canonical SMILES for 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol is CC(C)=CCOc1ccc(-c2cc(C)c(-c3ccc(O)cc3)c(C)c2)cc1O.
What is the InChIKey of 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol?
The InChIKey is UNNYGPSANBNIKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26O3/c1-16(2)11-12-28-24-10-7-20(15-23(24)27)21-13-17(3)25(18(4)14-21)19-5-8-22(26)9-6-19/h5-11,13-15,26-27H,12H2,1-4H3.
What are the key properties of 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol?
5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol has a molecular weight of 374.48 g/mol, XLogP of 6.39, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(4-hydroxyphenyl)-3,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenol is sourced from PubChem (CID 23539173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).