C26H27NO5 — CID 23538960
4-[4-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-2,5-dimethyl-3-nitrophenyl]phenol (PubChem CID 23538960) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 4-[4-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-2,5-dimethyl-3-nitrophenyl]phenol.
| Compound Name | 4-[4-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-2,5-dimethyl-3-nitrophenyl]phenol |
|---|---|
| PubChem CID | 23538960 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 4-[4-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-2,5-dimethyl-3-nitrophenyl]phenol |
| SMILES | COc1cc(-c2c(C)cc(-c3ccc(O)cc3)c(C)c2[N+](=O)[O-])ccc1OCC=C(C)C |
| InChI | InChI=1S/C26H27NO5/c1-16(2)12-13-32-23-11-8-20(15-24(23)31-5)25-17(3)14-22(18(4)26(25)27(29)30)19-6-9-21(28)10-7-19/h6-12,14-15,28H,13H2,1-5H3 |
| InChIKey | UAVKMVKZDLSENP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|