C29H33NO3 — CID 23539354
N-[2-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-3,6-dimethyl-5-(4-methylphenyl)phenyl]acetamide (PubChem CID 23539354) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-[2-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-3,6-dimethyl-5-(4-methylphenyl)phenyl]acetamide.
| Compound Name | N-[2-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-3,6-dimethyl-5-(4-methylphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 23539354 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-[2-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]-3,6-dimethyl-5-(4-methylphenyl)phenyl]acetamide |
| SMILES | COc1cc(-c2c(C)cc(-c3ccc(C)cc3)c(C)c2NC(C)=O)ccc1OCC=C(C)C |
| InChI | InChI=1S/C29H33NO3/c1-18(2)14-15-33-26-13-12-24(17-27(26)32-7)28-20(4)16-25(21(5)29(28)30-22(6)31)23-10-8-19(3)9-11-23/h8-14,16-17H,15H2,1-7H3,(H,30,31) |
| InChIKey | OFYMQRBOPCFPGM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|