C21H26O5S — CID 20585506
[5-[4-(hydroxymethyl)-2,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate (PubChem CID 20585506) has the molecular formula C21H26O5S and a molecular weight of 390.50 g/mol. Its IUPAC name is [5-[4-(hydroxymethyl)-2,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate.
| Compound Name | [5-[4-(hydroxymethyl)-2,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 20585506 |
| Molecular Formula | C21H26O5S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [5-[4-(hydroxymethyl)-2,5-dimethylphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate |
| SMILES | CC(C)=CCOc1ccc(-c2cc(C)c(CO)cc2C)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C21H26O5S/c1-14(2)8-9-25-20-7-6-17(12-21(20)26-27(5,23)24)19-11-15(3)18(13-22)10-16(19)4/h6-8,10-12,22H,9,13H2,1-5H3 |
| InChIKey | HTLDTCKALPTSBF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|