C28H32O12S3 — CID 23538260
[4-[3,6-dimethoxy-4-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]-2-methylsulfonyloxyphenyl]phenyl] methanesulfonate (PubChem CID 23538260) has the molecular formula C28H32O12S3 and a molecular weight of 656.75 g/mol. Its IUPAC name is [4-[3,6-dimethoxy-4-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]-2-methylsulfonyloxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[3,6-dimethoxy-4-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]-2-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538260 |
| Molecular Formula | C28H32O12S3 |
| Molecular Weight | 656.75 g/mol |
| Exact Mass | 656.11 |
| IUPAC Name | [4-[3,6-dimethoxy-4-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]-2-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OCC=C(C)C)c(OS(C)(=O)=O)c2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H32O12S3/c1-18(2)14-15-37-23-13-10-20(16-24(23)39-42(6,31)32)22-17-25(35-3)26(28(27(22)36-4)40-43(7,33)34)19-8-11-21(12-9-19)38-41(5,29)30/h8-14,16-17H,15H2,1-7H3 |
| InChIKey | ZVPHBDAOZJVOHJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|