C32H38O11S2 — CID 23539272
ethyl 3-[2,5-dimethoxy-6-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]-3-(4-methylsulfonyloxyphenyl)phenyl]propanoate (PubChem CID 23539272) has the molecular formula C32H38O11S2 and a molecular weight of 662.78 g/mol. Its IUPAC name is ethyl 3-[2,5-dimethoxy-6-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]-3-(4-methylsulfonyloxyphenyl)phenyl]propanoate.
| Compound Name | ethyl 3-[2,5-dimethoxy-6-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]-3-(4-methylsulfonyloxyphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 23539272 |
| Molecular Formula | C32H38O11S2 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | ethyl 3-[2,5-dimethoxy-6-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]-3-(4-methylsulfonyloxyphenyl)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1c(OC)c(-c2ccc(OS(C)(=O)=O)cc2)cc(OC)c1-c1ccc(OCC=C(C)C)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C32H38O11S2/c1-8-40-30(33)16-14-25-31(23-11-15-27(41-18-17-21(2)3)28(19-23)43-45(7,36)37)29(38-4)20-26(32(25)39-5)22-9-12-24(13-10-22)42-44(6,34)35/h9-13,15,17,19-20H,8,14,16,18H2,1-7H3 |
| InChIKey | VLZJPYDXEXSEQN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|