C25H28N2O13S3 — CID 23538512
[4-[4-[4-[(2Z)-2-amino-2-hydroxyiminoethoxy]-3-methylsulfonyloxyphenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate (PubChem CID 23538512) has the molecular formula C25H28N2O13S3 and a molecular weight of 660.70 g/mol. Its IUPAC name is [4-[4-[4-[(2Z)-2-amino-2-hydroxyiminoethoxy]-3-methylsulfonyloxyphenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[4-[4-[(2Z)-2-amino-2-hydroxyiminoethoxy]-3-methylsulfonyloxyphenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538512 |
| Molecular Formula | C25H28N2O13S3 |
| Molecular Weight | 660.70 g/mol |
| Exact Mass | 660.08 |
| IUPAC Name | [4-[4-[4-[(2Z)-2-amino-2-hydroxyiminoethoxy]-3-methylsulfonyloxyphenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(OC/C(N)=N/O)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C25H28N2O13S3/c1-35-21-13-18(15-6-9-17(10-7-15)38-41(3,29)30)24(36-2)25(40-43(5,33)34)23(21)16-8-11-19(37-14-22(26)27-28)20(12-16)39-42(4,31)32/h6-13,28H,14H2,1-5H3,(H2,26,27) |
| InChIKey | ZPWAYYOQCMKGCK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 216.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.70 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|